tert-Butyl spiro[indoline-3,4'-piperidine]-1-carboxylate structure
|
Common Name | tert-Butyl spiro[indoline-3,4'-piperidine]-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 676607-31-1 | Molecular Weight | 288.385 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2±28.7 °C | |
| Name | tert-butyl spiro[2H-indole-3,4'-piperidine]-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.4±45.0 °C at 760 mmHg |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.385 |
| Flash Point | 200.2±28.7 °C |
| Exact Mass | 288.183777 |
| PSA | 41.57000 |
| LogP | 3.63 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | UIEGYIFDVIDYHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCNCC2)c2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~79%
tert-Butyl spir... CAS#:676607-31-1 |
| Literature: JANSSEN PHARMACEUTICA N.V. Patent: WO2005/97794 A1, 2005 ; Location in patent: Page/Page column 43 ; WO 2005/097794 A1 |
|
~%
tert-Butyl spir... CAS#:676607-31-1 |
| Literature: WO2012/177782 A1, ; Page/Page column 108 ; WO 2012/177782 A1 |
|
~%
tert-Butyl spir... CAS#:676607-31-1 |
| Literature: WO2012/177782 A1, ; WO 2012/177782 A1 |
|
~%
tert-Butyl spir... CAS#:676607-31-1 |
| Literature: WO2012/177782 A1, ; WO 2012/177782 A1 |
|
~%
tert-Butyl spir... CAS#:676607-31-1 |
| Literature: WO2012/177782 A1, ; WO 2012/177782 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Spiro[3H-indole-3,4'-piperidine]-1(2H)-carboxylic acid, 1,1-dimethylethyl ester |
| TERT-BUTYL SPIRO[INDOLE-3,4'-PIPERIDINE]-1(2H)-CARBOXYLATE |
| 2-Methyl-2-propanyl spiro[indole-3,4'-piperidine]-1(2H)-carboxylate |
| wt1148 |
| fd6063 |
| tert-Butyl spiro[indoline-3,4'-iperidine]-1-carboxylate |