1,1,3,3-Tetrachloro-1,3-difluoro-2,2-propanediol structure
|
Common Name | 1,1,3,3-Tetrachloro-1,3-difluoro-2,2-propanediol | ||
|---|---|---|---|---|
| CAS Number | 677-70-3 | Molecular Weight | 249.85600 | |
| Density | 1.927g/cm3 | Boiling Point | 230.1ºC at 760 mmHg | |
| Molecular Formula | C3H2Cl4F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.9ºC | |
| Name | 1,1,3,3-tetrachloro-1,3-difluoropropane-2,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.927g/cm3 |
|---|---|
| Boiling Point | 230.1ºC at 760 mmHg |
| Molecular Formula | C3H2Cl4F2O2 |
| Molecular Weight | 249.85600 |
| Flash Point | 92.9ºC |
| Exact Mass | 247.87800 |
| PSA | 40.46000 |
| LogP | 1.86910 |
| Index of Refraction | 1.507 |
| InChIKey | ADCWDJKTUIBCPQ-UHFFFAOYSA-N |
| SMILES | OC(O)(C(F)(Cl)Cl)C(F)(Cl)Cl |
|
~%
1,1,3,3-Tetrach... CAS#:677-70-3 |
| Literature: Middleton,W.J.; Lindsey,R.V. Journal of the American Chemical Society, 1964 , vol. 86, p. 4948 - 4952 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2-Propanediol,1,1,3,3-tetrachloro-1,3-difluoro |
| 1,1,3,3-tetrachloro-1,3-difluoro-propan-2-one hydrate |
| 1,3-Difluor-1,1,3,3,-tetrachlor-aceton-hydrat |
| 1,1,3,3-Tetrachloro-1,3-difluoro-2,2-propanediol |
| 1,1,3,3-tetrachloro-1,3-difluoro-propane-2,2-diol |