[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite
![[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite Structure](https://image.chemsrc.com/caspic/289/677-88-3.png)
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite structure
|
Common Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite | ||
|---|---|---|---|---|
| CAS Number | 677-88-3 | Molecular Weight | 265.03400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4F9NO2 |
|---|---|
| Molecular Weight | 265.03400 |
| Exact Mass | 264.97900 |
| PSA | 38.66000 |
| LogP | 3.11010 |
| InChIKey | RXRPKUJRFRFWNX-UHFFFAOYSA-N |
| SMILES | O=NOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[1,1,1,3,3,3-he... CAS#:677-88-3 |
| Literature: Andreades,S. Journal of Organic Chemistry, 1962 , vol. 27, p. 4163 - 4170 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,1,3,3,3-hexafluoro-2-nitrosooxy-2-trifluoromethyl-propane |
| Nonafluor-tert-butyl-nitrit |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: Molecular formula of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is C4F9NO2. |
| Q: What English synonyms does [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite have? |
| A: English synonyms of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite: 1,1,1,3,3,3-hexafluoro-2-nitrosooxy-2-trifluoromethyl-propane, Nonafluor-tert-butyl-nitrit. |
| Q: What is the CAS number of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: CAS number of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is 677-88-3. |
| Q: What are the upstream materials of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: Related upstream materials(CAS) of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite: 354-93-8. |
| Q: What is the polar surface area (PSA) of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: Polar surface area (PSA) of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is 38.66000. |
| Q: What is the SMILES notation of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: SMILES notation of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is O=NOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F. |
| Q: What is the LogP of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: LogP of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is 3.11010. |
| Q: What is the molecular weight of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: Molecular weight of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is 265.03400. |
| Q: What is the InChIKey of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: InChIKey of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is RXRPKUJRFRFWNX-UHFFFAOYSA-N. |
| Q: What is the English name of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite? |
| A: The English name of [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] nitrite. |