(2E,4E,6E,8E,10E,12E)-pentadeca-2,4,6,8,10,12,14-heptaenoic acid structure
|
Common Name | (2E,4E,6E,8E,10E,12E)-pentadeca-2,4,6,8,10,12,14-heptaenoic acid | ||
|---|---|---|---|---|
| CAS Number | 67701-06-8 | Molecular Weight | 228.28600 | |
| Density | 1.003g/cm3 | Boiling Point | 435.3ºC at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | (2E,4E,6E,8E,10E,12E)-pentadeca-2,4,6,8,10,12,14-heptaenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.003g/cm3 |
|---|---|
| Boiling Point | 435.3ºC at 760 mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 200ºC |
| Exact Mass | 228.11500 |
| PSA | 37.30000 |
| LogP | 3.59420 |
| Index of Refraction | 1.556 |
| InChIKey | DTAMQBQGFSVRFE-IDFWPVMJSA-N |
| SMILES | C=CC=CC=CC=CC=CC=CC=CC(=O)O |
| SDA 04-005-00 |
| Fatty acids,C14-18 and C16-18-unsatd. |
| C14-C18 And C16-C18 alkylcarboxylic acid |
| Fatty acids C14-C18 and C16-C18 unsaturated |
| (C14-C18) and (C16-C18) Unsaturated alkylcarboxylic acid |
| EINECS 266-930-6 |