5-(5-Hydroxy-1-pentyn-1-yl)-6-phenyl-3(2H)-pyridazinone structure
|
Common Name | 5-(5-Hydroxy-1-pentyn-1-yl)-6-phenyl-3(2H)-pyridazinone | ||
|---|---|---|---|---|
| CAS Number | 677010-23-0 | Molecular Weight | 254.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(5-Hydroxy-1-pentyn-1-yl)-6-phenyl-3(2H)-pyridazinone |
|---|
| Molecular Formula | C15H14N2O2 |
|---|---|
| Molecular Weight | 254.28 |
| InChIKey | VITDQTVWHHEYJJ-UHFFFAOYSA-N |
| SMILES | O=c1cc(C#CCCCO)c(-c2ccccc2)n[nH]1 |
|
Name: The antiplatelet activity was tested by the turbidimetric method in washed human plat...
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL697813
|