5-methyl-5,7-dihydro-benzo[5',6']chromeno[3',2':5,6]pyrano[3,2-c]quinoline-6,8-dione
Modify Date: 2025-10-09 00:21:46
![5-methyl-5,7-dihydro-benzo[5',6']chromeno[3',2':5,6]pyrano[3,2-c]quinoline-6,8-dione Structure](https://image.chemsrc.com/caspic/121/67717-75-3.png)
5-methyl-5,7-dihydro-benzo[5',6']chromeno[3',2':5,6]pyrano[3,2-c]quinoline-6,8-dione structure
|
Common Name | 5-methyl-5,7-dihydro-benzo[5',6']chromeno[3',2':5,6]pyrano[3,2-c]quinoline-6,8-dione | ||
|---|---|---|---|---|
| CAS Number | 67717-75-3 | Molecular Weight | 381.38000 | |
| Density | 1.49g/cm3 | Boiling Point | 589.8ºC at 760 mmHg | |
| Molecular Formula | C24H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.5ºC | |
| Name | 5-methyl-5,7-dihydro-benzo[5',6']chromeno[3',2':5,6]pyrano[3,2-c]quinoline-6,8-dione |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 589.8ºC at 760 mmHg |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.38000 |
| Flash Point | 310.5ºC |
| Exact Mass | 381.10000 |
| PSA | 61.44000 |
| LogP | 4.49460 |
| Index of Refraction | 1.773 |
| InChIKey | PDGBQRJQQFLCST-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(c3ccccc31)Oc1oc3ccc4ccccc4c3c(=O)c1C2 |
|
~%
5-methyl-5,7-di... CAS#:67717-75-3 |
| Literature: Mazzei; Roma; Ermili Journal of Heterocyclic Chemistry, 1978 , vol. 15, # 4 p. 605 - 608 |
|
~%
5-methyl-5,7-di... CAS#:67717-75-3 |
| Literature: Mazzei; Roma; Ermili Journal of Heterocyclic Chemistry, 1978 , vol. 15, # 4 p. 605 - 608 |
|
~%
5-methyl-5,7-di... CAS#:67717-75-3 |
| Literature: Mazzei; Roma; Ermili Journal of Heterocyclic Chemistry, 1978 , vol. 15, # 4 p. 605 - 608 |
![3-(3-dimethylamino-1-oxo-1H-benzo[f]chromen-2-ylmethyl)-4-hydroxy-1-methyl-1H-quinolin-2-one structure](https://image.chemsrc.com/caspic/328/67717-65-1.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |