6-Methyl 3-propan-2-yl 2,7-dimethyl-4-(4-methyl-3-nitrophenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate
Modify Date: 2026-03-14 15:55:02
6-Methyl 3-propan-2-yl 2,7-dimethyl-4-(4-methyl-3-nitrophenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate structure
|
Common Name | 6-Methyl 3-propan-2-yl 2,7-dimethyl-4-(4-methyl-3-nitrophenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 677331-22-5 | Molecular Weight | 456.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Methyl 3-propan-2-yl 2,7-dimethyl-4-(4-methyl-3-nitrophenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate |
|---|
| Molecular Formula | C24H28N2O7 |
|---|---|
| Molecular Weight | 456.5 |
| InChIKey | QSKPBKCTDZXCHQ-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(C(=C(N2)C)C(=O)OC(C)C)C3=CC(=C(C=C3)C)[N+](=O)[O-])C(=O)C1C(=O)OC |
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 3, Current Page 1 of 1
1