Carbamicacid, (1-chloro-2,2,2-trifluoroethyl)-, phenylmethyl ester (9CI)
Modify Date: 2025-09-22 22:34:46
Carbamicacid, (1-chloro-2,2,2-trifluoroethyl)-, phenylmethyl ester (9CI) structure
|
Common Name | Carbamicacid, (1-chloro-2,2,2-trifluoroethyl)-, phenylmethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6776-48-3 | Molecular Weight | 267.63200 | |
| Density | 1.367g/cm3 | Boiling Point | 301.3ºC at 760 mmHg | |
| Molecular Formula | C10H9ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136ºC | |
| Name | benzyl N-(1-chloro-2,2,2-trifluoroethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 301.3ºC at 760 mmHg |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63200 |
| Flash Point | 136ºC |
| Exact Mass | 267.02700 |
| PSA | 38.33000 |
| LogP | 3.43090 |
| Index of Refraction | 1.481 |
| InChIKey | MGDUFVWEIZNPGG-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cl)C(F)(F)F)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Carbamicacid, (... CAS#:6776-48-3 |
| Literature: Weygand,F. et al. Chemische Berichte, 1966 , vol. 99, p. 1944 - 1956 |
|
~%
Carbamicacid, (... CAS#:6776-48-3 |
| Literature: Weygand,F. et al. Chemische Berichte, 1966 , vol. 99, p. 1944 - 1956 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2,2-Trifluoro-1-chlor-N-benzyloxycarbonylethylamin |
| EINECS 229-837-1 |
| 2,2,2-Trifluor-1-chlor-N-benzyloxycarbonyl-ethylamin |
| 2,2,2-Trifluor-1-chlor-N-benzyloxycarbonyl-aethylamin |