1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)
![1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) Structure](https://image.chemsrc.com/caspic/159/677752-10-2.png)
1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) structure
|
Common Name | 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 677752-10-2 | Molecular Weight | 198.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18O3 |
|---|---|
| Molecular Weight | 198.25900 |
| Exact Mass | 198.12600 |
| PSA | 38.69000 |
| LogP | 1.60750 |
| InChIKey | GXUPJTLEDBKSRO-IQJOONFLSA-N |
| SMILES | C=C1CCC2(OC(C)(C)OC2C)C1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![Spiro[1,3-dioxolane-4,2-[6]oxabicyclo[3.1.0]hexane], 2,2,5,5-tetramethyl-, (1R,2R,5S,5R)- (9CI) structure](https://image.chemsrc.com/caspic/139/677751-95-0.png)
![(4S,5S)-2,2,4,7-tetramethyl-1,3-dioxaspiro[4.4]non-6-ene structure](https://image.chemsrc.com/caspic/214/677752-04-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: Molecular weight of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is 198.25900. |
| Q: What is the SMILES notation of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: SMILES notation of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is C=C1CCC2(OC(C)(C)OC2C)C1O. |
| Q: What is the LogP of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: LogP of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is 1.60750. |
| Q: What is the Chinese name of 677752-10-2? |
| A: Chinese name of 677752-10-2 is 677752-10-2. |
| Q: What are the upstream materials of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: Related upstream materials(CAS) of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI): 677751-95-0;82010-51-3;677752-02-2;677752-03-3;677752-04-4. |
| Q: What is the CAS number of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: CAS number of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is 677752-10-2. |
| Q: What is the polar surface area (PSA) of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: Polar surface area (PSA) of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is 38.69000. |
| Q: What is the InChIKey of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: InChIKey of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is GXUPJTLEDBKSRO-IQJOONFLSA-N. |
| Q: What is the English name of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: The English name of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI). |
| Q: What is the molecular formula of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI)? |
| A: Molecular formula of 1,3-Dioxaspiro[4.4]nonan-6-ol,2,2,4-trimethyl-7-methylene-,(4S,5S,6R)-(9CI) is C11H18O3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |