aniline,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol structure
|
Common Name | aniline,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 67784-74-1 | Molecular Weight | 321.41300 | |
| Density | N/A | Boiling Point | 400.8ºC at 760 mmHg | |
| Molecular Formula | C21H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.5ºC | |
| Name | aniline,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 400.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.41300 |
| Flash Point | 192.5ºC |
| Exact Mass | 321.17300 |
| PSA | 66.48000 |
| LogP | 5.27370 |
| InChIKey | UMBCKFDQILWGJI-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.Nc1ccccc1 |
| Aniline,formaldehyde polymer,reaction product with maleic anhydride,cyclized |
| Formaldehyde,polymer with benzenamine,maleated,cyclized |