4-methylsulfonyl-2,6-dinitro-N-propylaniline structure
|
Common Name | 4-methylsulfonyl-2,6-dinitro-N-propylaniline | ||
|---|---|---|---|---|
| CAS Number | 67810-34-8 | Molecular Weight | 303.29200 | |
| Density | 1.462g/cm3 | Boiling Point | 496.4ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | 4-methylsulfonyl-2,6-dinitro-N-propylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760 mmHg |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.29200 |
| Flash Point | 254ºC |
| Exact Mass | 303.05300 |
| PSA | 146.19000 |
| LogP | 3.92860 |
| Index of Refraction | 1.588 |
| InChIKey | DFNAFDHFFUVITM-UHFFFAOYSA-N |
| SMILES | CCCNc1c([N+](=O)[O-])cc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-methanesulfonyl-2,6-dinitro-N-propylaniline |