5-(3,4-dichlorophenyl)pyrazine-2,3-dicarbonitrile structure
|
Common Name | 5-(3,4-dichlorophenyl)pyrazine-2,3-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 67823-12-5 | Molecular Weight | 275.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H4Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3,4-dichlorophenyl)pyrazine-2,3-dicarbonitrile |
|---|
| Molecular Formula | C12H4Cl2N4 |
|---|---|
| Molecular Weight | 275.09300 |
| Exact Mass | 273.98100 |
| PSA | 73.36000 |
| LogP | 3.19376 |
| InChIKey | YLGVMXUSXMPIRK-UHFFFAOYSA-N |
| SMILES | N#Cc1ncc(-c2ccc(Cl)c(Cl)c2)nc1C#N |
|
~%
5-(3,4-dichloro... CAS#:67823-12-5 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Takeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1555 - 1560 |
|
~74%
5-(3,4-dichloro... CAS#:67823-12-5 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Takeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1555 - 1560 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |