butyl prop-2-enoate,ethenyl acetate,ethenyl 8-methylnonanoate structure
|
Common Name | butyl prop-2-enoate,ethenyl acetate,ethenyl 8-methylnonanoate | ||
|---|---|---|---|---|
| CAS Number | 67828-12-0 | Molecular Weight | 412.56000 | |
| Density | N/A | Boiling Point | 246.6ºC at 760 mmHg | |
| Molecular Formula | C23H40O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 83.6ºC | |
| Name | butyl prop-2-enoate,ethenyl acetate,ethenyl 8-methylnonanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 246.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.56000 |
| Flash Point | 83.6ºC |
| Exact Mass | 412.28200 |
| PSA | 78.90000 |
| LogP | 5.87840 |
| InChIKey | HVEQWLVDOBXPAM-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCC.C=COC(=O)CCCCCCC(C)C.C=COC(C)=O |
| ethenyl 8-methylnonanoate |
| Vinyl acetate,vinyl versatate,butyl acrylate polymer |
| tert-Decanoic acid,ethenyl ester,polymer with butyl 2-propenoate and ethenyl acetate |