bis[[6-anilino-4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:2) structure
|
Common Name | bis[[6-anilino-4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:2) | ||
|---|---|---|---|---|
| CAS Number | 67828-26-6 | Molecular Weight | 1215.36000 | |
| Density | N/A | Boiling Point | 1421.2ºC at 760 mmHg | |
| Molecular Formula | C52H74N14O16S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 813.3ºC | |
| Name | 5-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|
| Boiling Point | 1421.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C52H74N14O16S2 |
| Molecular Weight | 1215.36000 |
| Flash Point | 813.3ºC |
| Exact Mass | 1214.48000 |
| PSA | 479.14000 |
| InChIKey | LHVSEHSXMVXQST-YHPRVSEPSA-N |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Nc3ccccc3)nc(N(CCO)CCO)n2)ccc1C=Cc1ccc(Nc2nc(Nc3ccccc3)nc(N(CCO)CCO)n2)cc1S(=O)(=O)O.OCCN(CCO)CCO.OCCN(CCO)CCO |