naphthalene-2,7-disulphonic acid, compound with 4-(diethylamino)-alpha-[4-(diethylamino)phenyl]benzenemethanol (1:1) structure
|
Common Name | naphthalene-2,7-disulphonic acid, compound with 4-(diethylamino)-alpha-[4-(diethylamino)phenyl]benzenemethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67828-31-3 | Molecular Weight | 614.773 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H38N2O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,7-Naphthalenedisulfonic acid, 4,4'-bis(diethylamino)benzhydrol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H38N2O7S2 |
|---|---|
| Molecular Weight | 614.773 |
| Exact Mass | 614.212036 |
| InChIKey | VZXHRZHLSFNNMC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C(O)c2ccc(N(CC)CC)cc2)cc1.O=S(=O)(O)c1ccc2ccc(S(=O)(=O)O)cc2c1 |
| 2,7-Naphthalenedisulfonic acid, compd. with 4-(diethylamino)-α-[4-(diethylamino)phenyl]benzenemethanol (1:1) |
| Naphthalene-2,7-disulphonic acid, compound with 4-(diethylamino)-α-(4-(diethylamino)phenyl)benzenemethanol (1:1) |
| 2,7-Naphthalenedisulfonic acid, 4,4'-bis(diethylamino)benzhydrol |
| 2,7-Naphthalenedisulfonic acid, compd. with 4-(diethylamino)-α-[4-(diethylamino)phenyl]benzenemethanol (1:1) |
| 2,7-Naphthalenedisulfonic acid - bis[4-(diethylamino)phenyl]methanol (1:1) |
| EINECS 267-253-9 |
| 2,7-Naphthalenedisulfonic acid, compd. with 4-(diethylamino)-α-(4-(diethylamino)phenyl)benzenemethanol (1:1) |