2,5-dimethyl-3,4-bis(trifluoromethyl)furan structure
|
Common Name | 2,5-dimethyl-3,4-bis(trifluoromethyl)furan | ||
|---|---|---|---|---|
| CAS Number | 67837-81-4 | Molecular Weight | 232.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dimethyl-3,4-bis(trifluoromethyl)furan |
|---|
| Molecular Formula | C8H6F6O |
|---|---|
| Molecular Weight | 232.12300 |
| Exact Mass | 232.03200 |
| PSA | 13.14000 |
| LogP | 3.93400 |
| InChIKey | WBEBAIGXUHSPNB-UHFFFAOYSA-N |
| SMILES | Cc1oc(C)c(C(F)(F)F)c1C(F)(F)F |
|
~62%
2,5-dimethyl-3,... CAS#:67837-81-4 |
| Literature: Chambers, Richard D.; Roche, Alex J.; Rock, Michael H. Journal of the Chemical Society. Perkin Transactions 2, 1996 , vol. 1996, # 11 p. 1095 - 1100 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |