dibutyl hydrogen phosphite, compound with methyl-1H-benzotriazole (1:1) structure
|
Common Name | dibutyl hydrogen phosphite, compound with methyl-1H-benzotriazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67845-60-7 | Molecular Weight | 327.359 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N3O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dibutyl hydrogen phosphite-1-methyl-1H-benzotriazole (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H26N3O3P |
|---|---|
| Molecular Weight | 327.359 |
| Exact Mass | 327.171173 |
| InChIKey | ZSAWMUYKPZWYNT-UHFFFAOYSA-N |
| SMILES | CCCCOP(O)OCCCC.Cc1ccc2n[nH]nc2c1 |
| EINECS 267-332-8 |
| Dibutyl hydrogen phosphite - 1-methyl-1H-benzotriazole (1:1) |
| Phosphorous acid, dibutyl ester, compd. with 1-methyl-1H-1,2,3-benzotriazole (1:1) |
| Phosphorous acid, dibutyl ester, compd. with methyl-1H-benzotriazole (1:1) |