isopentyl octyl hydrogen phosphate, compound with 2-(dibutylamino)ethanol (1:1) structure
|
Common Name | isopentyl octyl hydrogen phosphate, compound with 2-(dibutylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67846-41-7 | Molecular Weight | 453.63600 | |
| Density | N/A | Boiling Point | 352.7ºC at 760 mmHg | |
| Molecular Formula | C23H52NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 2-(dibutylamino)ethanol,3-methylbutyl octyl hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 352.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H52NO5P |
| Molecular Weight | 453.63600 |
| Flash Point | 167.1ºC |
| Exact Mass | 453.35800 |
| PSA | 89.04000 |
| LogP | 6.40750 |
| InChIKey | ZXUHSVBWXVYYKE-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOP(=O)(O)OCCC(C)C.CCCCN(CCO)CCCC |
| Phosphoric acid,3-methylbutyl octyl ester,dibutylethanolamine salt |
| EINECS 267-364-2 |