3-O-ethyl 2-O-methyl 4-methyl-1H-pyrrole-2,3-dicarboxylate structure
|
Common Name | 3-O-ethyl 2-O-methyl 4-methyl-1H-pyrrole-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 67855-96-3 | Molecular Weight | 211.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-O-ethyl 2-O-methyl 4-methyl-1H-pyrrole-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO4 |
|---|---|
| Molecular Weight | 211.21500 |
| Exact Mass | 211.08400 |
| PSA | 68.39000 |
| LogP | 1.28640 |
| InChIKey | YNDMIOHDZDALCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)c[nH]c1C(=O)OC |
|
~%
3-O-ethyl 2-O-m... CAS#:67855-96-3 |
| Literature: Corwin; Straughn Journal of the American Chemical Society, 1948 , vol. 70, p. 1416,1420 |
|
~%
3-O-ethyl 2-O-m... CAS#:67855-96-3 |
| Literature: Fischer; Wiedemann Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1926 , vol. 155, p. 61 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Methyl-pyrrol-2,3-dicarbonsaeure-3-aethylester-2-methylester |
| 1H-Pyrrole-2,3-dicarboxylic acid,4-methyl-,3-ethyl 2-methyl ester |
| 4-methyl-pyrrole-2,3-dicarboxylic acid 3-ethyl ester 2-methyl ester |
| 3-ethyl 2-methyl 4-methyl-1H-pyrrole-2,3-dicarboxylate |
| 2-methoxycarbonyl-3-ethoxycarbonyl-4-methylpyrrole |