p-tert-butylbenzoic acid, compound with 1-aminopropan-2-ol (1:1) structure
|
Common Name | p-tert-butylbenzoic acid, compound with 1-aminopropan-2-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67859-80-7 | Molecular Weight | 253.33700 | |
| Density | N/A | Boiling Point | 283.3ºC at 760 mmHg | |
| Molecular Formula | C14H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.9ºC | |
| Name | 1-aminopropan-2-ol,4-tert-butylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 283.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.33700 |
| Flash Point | 134.9ºC |
| Exact Mass | 253.16800 |
| PSA | 83.55000 |
| LogP | 2.70850 |
| InChIKey | DTUPQRXSFPBPHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)O)cc1.CC(O)CN |
| p-tert-Butylbenzoic acid,monoisopropanolamine salt |
| EINECS 267-429-5 |
| p-tert-Butylbenzoic acid,isopropanolamine salt |