butyl prop-2-enoate,dimethyl (Z)-but-2-enedioate,ethenyl acetate structure
|
Common Name | butyl prop-2-enoate,dimethyl (Z)-but-2-enedioate,ethenyl acetate | ||
|---|---|---|---|---|
| CAS Number | 67859-83-0 | Molecular Weight | 358.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl prop-2-enoate,dimethyl (Z)-but-2-enedioate,ethenyl acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O8 |
|---|---|
| Molecular Weight | 358.38400 |
| Exact Mass | 358.16300 |
| PSA | 105.20000 |
| LogP | 2.09730 |
| InChIKey | RCNPUXIKUDBTIO-LWFKIUJUSA-N |
| SMILES | C=CC(=O)OCCCC.C=COC(C)=O.COC(=O)C=CC(=O)OC |
| 2-Butenedioic acid (2Z)-,dimethyl ester,polymer with butyl 2-propenoate and ethenyl acetate |
| dimethyl (Z)-but-2-enedioate |
| 2-Butenedioic acid (2Z)-,1,4-dimethyl ester,polymer with butyl 2-propenoate and ethenyl acetate |
| Vinyl acetate,polymer with butylacrylate and dimethyl maleate |