octyl dihydrogen phosphate, compound with 2,2'-iminodiethanol structure
|
Common Name | octyl dihydrogen phosphate, compound with 2,2'-iminodiethanol | ||
|---|---|---|---|---|
| CAS Number | 67874-53-7 | Molecular Weight | 315.344 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H30NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Octyl dihydrogen phosphate-2,2'-iminodiethanol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H30NO6P |
|---|---|
| Molecular Weight | 315.344 |
| Exact Mass | 315.181061 |
| InChIKey | ITSXQPHPQLBAHV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOP(=O)(O)O.OCCNCCO |
| EINECS 265-557-6 |
| EINECS 269-501-1 |
| Phosphoric acid, monooctyl ester, compd. with 2,2′-iminobis[ethanol] (1:) |
| Phosphoric acid, octyl ester, compd. with 2,2'-iminobis(ethanol) |
| Octyl dihydrogen phosphate - 2,2'-iminodiethanol (1:1) |
| Phosphoric acid, octyl ester, compd. with 2,2'-iminobis[ethanol] (1:1) |
| EINECS 267-480-3 |