geranyl anthranilate structure
|
Common Name | geranyl anthranilate | ||
|---|---|---|---|---|
| CAS Number | 67874-69-5 | Molecular Weight | 273.37000 | |
| Density | 1.031g/cm3 | Boiling Point | 418.6ºC at 760mmHg | |
| Molecular Formula | C17H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | geranyl anthranilate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760mmHg |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37000 |
| Flash Point | 247.2ºC |
| Exact Mass | 273.17300 |
| PSA | 52.32000 |
| LogP | 4.69950 |
| InChIKey | QLRICECRKJGSKQ-SDNWHVSQSA-N |
| SMILES | CC(C)=CCCC(C)=CCOC(=O)c1ccccc1N |
|
~70%
geranyl anthranilate CAS#:67874-69-5 |
| Literature: Sharma; Rathee, Raman Journal of the Indian Chemical Society, 2006 , vol. 83, # 11 p. 1158 - 1159 |
|
~%
geranyl anthranilate CAS#:67874-69-5 |
| Literature: Verley Bulletin de la Societe Chimique de France, 1927 , vol. <4> 41, p. 789 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| geranyl antranilate |
| Anthranilsaeure-geranylester |
| anthranilic acid geranyl ester |
| Einecs 267-497-6 |