(Z)-1-(1-adamantyl)-2-(benzenesulfonyl)ethenamine structure
|
Common Name | (Z)-1-(1-adamantyl)-2-(benzenesulfonyl)ethenamine | ||
|---|---|---|---|---|
| CAS Number | 67886-57-1 | Molecular Weight | 317.44600 | |
| Density | 1.261g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C18H23NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | 1-(1-adamantyl)-2-(benzenesulfonyl)ethenamine |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.44600 |
| Flash Point | 251.5ºC |
| Exact Mass | 317.14500 |
| PSA | 68.54000 |
| LogP | 5.25790 |
| Index of Refraction | 1.618 |
| InChIKey | RSGLQTJQWLKOHQ-ATVHPVEESA-N |
| SMILES | NC(=CS(=O)(=O)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
|
~%
(Z)-1-(1-adaman... CAS#:67886-57-1 |
| Literature: Bartlett,P.A. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 4852 - 4858 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |