6,7,14,15,22,23-Hexaoxatrispiro[4.2.5.2.5.2]- tricosane structure
|
Common Name | 6,7,14,15,22,23-Hexaoxatrispiro[4.2.5.2.5.2]- tricosane | ||
|---|---|---|---|---|
| CAS Number | 6789-46-4 | Molecular Weight | 328.40100 | |
| Density | 1.2g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C17H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | 6,7,14,15,22,23-hexaoxatrispiro[4.2.58.2.516.25]tricosane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.40100 |
| Flash Point | 160.2ºC |
| Exact Mass | 328.18900 |
| PSA | 55.38000 |
| LogP | 4.43570 |
| Index of Refraction | 1.523 |
| InChIKey | NEOONNXGGPYFAH-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)OOC1(CCCCC1)OOC1(CCCC1)OO2 |
|
~84%
6,7,14,15,22,23... CAS#:6789-46-4 |
| Literature: Terent'ev, Alexander O.; Platonov, Maxim M.; Sonneveld, Eduard J.; Peschar, Rene; Chernyshev, Vladimir V.; Starikova, Zoya A.; Nikishin, Gennady I. Journal of Organic Chemistry, 2007 , vol. 72, # 19 p. 7237 - 7243 |
|
~%
6,7,14,15,22,23... CAS#:6789-46-4 |
| Literature: Terent'ev, Alexander O.; Platonov, Maxim M.; Sonneveld, Eduard J.; Peschar, Rene; Chernyshev, Vladimir V.; Starikova, Zoya A.; Nikishin, Gennady I. Journal of Organic Chemistry, 2007 , vol. 72, # 19 p. 7237 - 7243 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dicyclohexyliden-cyclopentyliden-triperoxid |
| Dicyclohexyliden-cyclopentyliden-peroxid |
| 6,7,14,15,22,23-hexaoxatrispiro[4.2.58.2.516.25]tricosane |
| Dicyclohexyliden-cyclopentyliden |