Propanimidamide,2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoro-1-iminopropyl)
Modify Date: 2025-10-02 15:43:06
Propanimidamide,2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoro-1-iminopropyl) structure
|
Common Name | Propanimidamide,2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoro-1-iminopropyl) | ||
|---|---|---|---|---|
| CAS Number | 679-25-4 | Molecular Weight | 307.09200 | |
| Density | 1.72g/cm3 | Boiling Point | 119ºC at 760mmHg | |
| Molecular Formula | C6H3F10N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 25.8ºC | |
| Name | 1-amino-4-(4-amino-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 119ºC at 760mmHg |
| Molecular Formula | C6H3F10N3 |
| Molecular Weight | 307.09200 |
| Flash Point | 25.8ºC |
| Exact Mass | 307.01700 |
| PSA | 59.73000 |
| LogP | 3.51610 |
| Index of Refraction | 1.345 |
| InChIKey | YIUFNCNUNJLQKS-UHFFFAOYSA-N |
| SMILES | N=C(N=C(N)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
|
~%
Propanimidamide... CAS#:679-25-4 |
| Literature: Brown,H.C.; Schuman,P.D. Journal of Organic Chemistry, 1963 , vol. 28, p. 1122 - 1127 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N'-<Pentafluor-propionimidoyl>-pentafluor-propionamidin |