6,15-Dihydro-8-hydroxy-5,9,14,18-anthrazinetetrone structure
|
Common Name | 6,15-Dihydro-8-hydroxy-5,9,14,18-anthrazinetetrone | ||
|---|---|---|---|---|
| CAS Number | 67905-10-6 | Molecular Weight | 458.42100 | |
| Density | 1.549g/cm3 | Boiling Point | 766ºC at 760 mmHg | |
| Molecular Formula | C28H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 417.1ºC | |
| Name | 8-hydroxy-6,15-dihydro-dinaphtho[2,3-a,2',3'-h]phenazine-5,9,14,18-tetraone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549g/cm3 |
|---|---|
| Boiling Point | 766ºC at 760 mmHg |
| Molecular Formula | C28H14N2O5 |
| Molecular Weight | 458.42100 |
| Flash Point | 417.1ºC |
| Exact Mass | 458.09000 |
| PSA | 120.09000 |
| LogP | 3.84620 |
| Index of Refraction | 1.767 |
| InChIKey | IXSRYWSRXKVPPA-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2c(=O)c2c1ccc1[nH]c3c(cc(O)c4c(=O)c5ccccc5c(=O)c43)[nH]c12 |
|
~%
6,15-Dihydro-8-... CAS#:67905-10-6 |
| Literature: Bayer and Co. Patent: DE178130 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 346 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,9,14,18-Anthrazinetetrone,6,15-dihydro-8-hydroxy |