diethyl 2-acetamido-2-(5-nitropyridin-2-yl)propanedioate structure
|
Common Name | diethyl 2-acetamido-2-(5-nitropyridin-2-yl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 67938-67-4 | Molecular Weight | 339.30100 | |
| Density | 1.322g/cm3 | Boiling Point | 509.9ºC at 760 mmHg | |
| Molecular Formula | C14H17N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | diethyl 2-acetamido-2-(5-nitropyridin-2-yl)propanedioate |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 509.9ºC at 760 mmHg |
| Molecular Formula | C14H17N3O7 |
| Molecular Weight | 339.30100 |
| Flash Point | 262.2ºC |
| Exact Mass | 339.10700 |
| PSA | 140.41000 |
| LogP | 1.36150 |
| Index of Refraction | 1.532 |
| InChIKey | LHWFQJFPKIQJOV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NC(C)=O)(C(=O)OCC)c1ccc([N+](=O)[O-])cn1 |
|
~%
diethyl 2-aceta... CAS#:67938-67-4 |
| Literature: MERCK SHARP and DOHME CORP.; RAGHAVAN, Subharekha; STELMACH, John, E.; SMITH, Cameron, J.; LI, Hong; WHITEHEAD, Alan; WADDELL, Sherman, T.; CHEN, Yi-Heng; MIAO, Shouwu; ORNOSKI, Olga, A.; GARFUNKLE, Joie; LIAO, Xibin; CHANG, Jiang; HAN, Xiaoqing; GUO, Jian; GROEPER, Jonathan, A.; BROCKUNIER, Linda, L.; ROSAUER, Keith; PARMEE, Emma, R. Patent: WO2011/149921 A1, 2011 ; Location in patent: Page/Page column 51; 87 ; |