Quinolinium, 2-[(dithiocarboxy)methyl]-1,6-dimethyl-, hydroxide, inner salt structure
|
Common Name | Quinolinium, 2-[(dithiocarboxy)methyl]-1,6-dimethyl-, hydroxide, inner salt | ||
|---|---|---|---|---|
| CAS Number | 67943-66-2 | Molecular Weight | 247.37900 | |
| Density | 1.168g/cm3 | Boiling Point | 392.2ºC at 760 mmHg | |
| Molecular Formula | C13H13NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | Quinolinium, 2-[(dithiocarboxy)methyl]-1,6-dimethyl-, hydroxide, inner salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 392.2ºC at 760 mmHg |
| Molecular Formula | C13H13NS2 |
| Molecular Weight | 247.37900 |
| Flash Point | 191ºC |
| Exact Mass | 247.04900 |
| PSA | 35.97000 |
| LogP | 2.38950 |
| Index of Refraction | 1.626 |
| InChIKey | MPQRVXCNDLDKSH-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(ccc(CC(=S)[S-])[n+]2C)c1 |
|
~%
Quinolinium, 2-... CAS#:67943-66-2 |
| Literature: Foye; Kauffman Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 4 p. 477 - 480 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-(1,6-dimethylquinolin-2-yl)ethanedithioate |