1-hydroxypropan-2-yl 2-methylprop-2-enoate,2-methyloxirane structure
|
Common Name | 1-hydroxypropan-2-yl 2-methylprop-2-enoate,2-methyloxirane | ||
|---|---|---|---|---|
| CAS Number | 67969-71-5 | Molecular Weight | 202.24800 | |
| Density | N/A | Boiling Point | 218.8ºC at 760 mmHg | |
| Molecular Formula | C10H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 86.9ºC | |
| Name | 1-hydroxypropan-2-yl 2-methylprop-2-enoate,2-methyloxirane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 218.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.24800 |
| Flash Point | 86.9ºC |
| Exact Mass | 202.12100 |
| PSA | 59.06000 |
| LogP | 0.89160 |
| InChIKey | MEFXJDBUTREXPB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC(C)CO.CC1CO1 |
| 2-Propenoic acid,2-methyl-,monoester with 1,2-propanediol,polymer with 2-methyloxirane |
| 2-Propenoic acid,2-methyl-,monoester with 1,2-propanediol,polymer with methyloxirane |
| Hydroxypropyl methacrylate,propylene oxide polymer |