4,7-Methano-1H-inden-6-ol,3a,4,5,6,7,7a-hexahydro-,polymer with 1,3-diisocyanatomethylbenzene structure
|
Common Name | 4,7-Methano-1H-inden-6-ol,3a,4,5,6,7,7a-hexahydro-,polymer with 1,3-diisocyanatomethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 67969-76-0 | Molecular Weight | 324.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,7-Methano-1H-inden-6-ol,3a,4,5,6,7,7a-hexahydro-,polymer with 1,3-diisocyanatomethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20N2O3 |
|---|---|
| Molecular Weight | 324.37400 |
| Exact Mass | 324.14700 |
| PSA | 79.09000 |
| LogP | 3.50900 |
| InChIKey | NLLJKCURHHMBNW-UHFFFAOYSA-N |
| SMILES | Cc1c(N=C=O)cccc1N=C=O.OC1CC2CC1C1CC=CC21 |
| 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-ol,toluene diisocyanate polymer |