1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione structure
|
Common Name | 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6797-46-2 | Molecular Weight | 225.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8ClNO3 |
|---|---|
| Molecular Weight | 225.62800 |
| Exact Mass | 225.01900 |
| PSA | 66.73000 |
| LogP | 1.94190 |
| InChIKey | OOQSQUHNDCGPMQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(N=O)=C(O)c1ccc(Cl)cc1 |
|
~%
1-(4-chlorophen... CAS#:6797-46-2 |
| Literature: Desai, B.J.; Shinde, V.M. Journal of the Indian Chemical Society, 1984 , vol. 61, p. 695 - 697 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| p-chloroisonitrosobenzoylacetone |
| 1-<4-Chlor-phenyl-butan-1,2,3-trion-2-oxim |
| Hydroxyimino-p-chlorbenzoylaceton |