1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione
1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione structure
|
Common Name | 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6797-46-2 | Molecular Weight | 225.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8ClNO3 |
|---|---|
| Molecular Weight | 225.62800 |
| Exact Mass | 225.01900 |
| PSA | 66.73000 |
| LogP | 1.94190 |
| InChIKey | OOQSQUHNDCGPMQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(N=O)=C(O)c1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(4-chlorophen... CAS#:6797-46-2 |
| Literature: Desai, B.J.; Shinde, V.M. Journal of the Indian Chemical Society, 1984 , vol. 61, p. 695 - 697 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-chloroisonitrosobenzoylacetone |
| 1-<4-Chlor-phenyl-butan-1,2,3-trion-2-oxim |
| Hydroxyimino-p-chlorbenzoylaceton |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: Molecular formula of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is C10H8ClNO3. |
| Q: What is the CAS number of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: CAS number of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is 6797-46-2. |
| Q: What is the InChIKey of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: InChIKey of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is OOQSQUHNDCGPMQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 6797-46-2? |
| A: Chinese name of 6797-46-2 is 6797-46-2. |
| Q: What is the English name of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: The English name of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione. |
| Q: What English synonyms does 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione have? |
| A: English synonyms of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione: p-chloroisonitrosobenzoylacetone, 1-<4-Chlor-phenyl-butan-1,2,3-trion-2-oxim, Hydroxyimino-p-chlorbenzoylaceton. |
| Q: What is the molecular weight of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: Molecular weight of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is 225.62800. |
| Q: What is the SMILES notation of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: SMILES notation of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is CC(=O)C(N=O)=C(O)c1ccc(Cl)cc1. |
| Q: What is the polar surface area (PSA) of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: Polar surface area (PSA) of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione is 66.73000. |
| Q: What are the upstream materials of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione? |
| A: Related upstream materials(CAS) of 1-(4-chlorophenyl)-2-hydroxyiminobutane-1,3-dione: 6302-55-2. |