dibutylnaphthalenesulphonic acid, compound with butylamine (1:1) structure
|
Common Name | dibutylnaphthalenesulphonic acid, compound with butylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67970-28-9 | Molecular Weight | 393.58300 | |
| Density | N/A | Boiling Point | 568.9ºC at 760 mmHg | |
| Molecular Formula | C22H35NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.9ºC | |
| Name | butan-1-amine,2,3-dibutylnaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 568.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C22H35NO3S |
| Molecular Weight | 393.58300 |
| Flash Point | 297.9ºC |
| Exact Mass | 393.23400 |
| PSA | 88.77000 |
| LogP | 7.29800 |
| InChIKey | WZJFYALNAZEBHJ-UHFFFAOYSA-N |
| SMILES | CCCCN.CCCCc1cc2ccccc2c(S(=O)(=O)O)c1CCCC |
| Dibutylnaphthalenesulfonic acid,butylamine salt |
| EINECS 268-002-6 |