di(tert-pentyl)naphthalenesulphonic acid, compound with cyclohexylamine (1:1) structure
|
Common Name | di(tert-pentyl)naphthalenesulphonic acid, compound with cyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 67970-31-4 | Molecular Weight | 447.67400 | |
| Density | N/A | Boiling Point | 598.8ºC at 760 mmHg | |
| Molecular Formula | C26H41NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.9ºC | |
| Name | 2,3-bis(2-methylbutan-2-yl)naphthalene-1-sulfonic acid,cyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 598.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H41NO3S |
| Molecular Weight | 447.67400 |
| Flash Point | 315.9ºC |
| Exact Mass | 447.28100 |
| PSA | 88.77000 |
| LogP | 8.52060 |
| InChIKey | VSWDADQCNAKHGC-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1cc2ccccc2c(S(=O)(=O)O)c1C(C)(C)CC.NC1CCCCC1 |
| EINECS 268-004-7 |
| Di-tert-amylnaphthalenesulfonic acid,cyclohexylamine salt |