2-(1-Benzothiophen-2-yl)benzoic acid
Modify Date: 2026-06-28 10:03:12
2-(1-Benzothiophen-2-yl)benzoic acid structure
|
Common Name | 2-(1-Benzothiophen-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6798-16-9 | Molecular Weight | 254.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-Benzothiophen-2-yl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10O2S |
|---|---|
| Molecular Weight | 254.31 |
| InChIKey | YAZHSSSQPLDAAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=CC=CC=C3C(=O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of porcine kidney tissue non-specific alkaline phosphatase assessed as res...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1068635
|
|
Name: Inhibition of bovine intestinal alkaline phosphatase assessed as residual enzyme acti...
Source: ChEMBL
Target: Intestinal-type alkaline phosphatase
External Id: CHEMBL1068634
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(1-Benzothiophen-2-yl)benzoic acid? |
| A: The English name of 2-(1-Benzothiophen-2-yl)benzoic acid is 2-(1-Benzothiophen-2-yl)benzoic acid. |
| Q: What is the molecular weight of 2-(1-Benzothiophen-2-yl)benzoic acid? |
| A: Molecular weight of 2-(1-Benzothiophen-2-yl)benzoic acid is 254.31. |
| Q: What is the SMILES notation of 2-(1-Benzothiophen-2-yl)benzoic acid? |
| A: SMILES notation of 2-(1-Benzothiophen-2-yl)benzoic acid is C1=CC=C2C(=C1)C=C(S2)C3=CC=CC=C3C(=O)O. |
| Q: What is the CAS number of 2-(1-Benzothiophen-2-yl)benzoic acid? |
| A: CAS number of 2-(1-Benzothiophen-2-yl)benzoic acid is 6798-16-9. |
| Q: What is the molecular formula of 2-(1-Benzothiophen-2-yl)benzoic acid? |
| A: Molecular formula of 2-(1-Benzothiophen-2-yl)benzoic acid is C15H10O2S. |
| Q: What is the InChIKey of 2-(1-Benzothiophen-2-yl)benzoic acid? |
| A: InChIKey of 2-(1-Benzothiophen-2-yl)benzoic acid is YAZHSSSQPLDAAX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 6798-16-9? |
| A: Chinese name of 6798-16-9 is 6798-16-9. |