2-(1-Benzothiophen-2-yl)benzoic acid
Modify Date: 2026-04-20 12:44:28
2-(1-Benzothiophen-2-yl)benzoic acid structure
|
Common Name | 2-(1-Benzothiophen-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6798-16-9 | Molecular Weight | 254.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-Benzothiophen-2-yl)benzoic acid |
|---|
| Molecular Formula | C15H10O2S |
|---|---|
| Molecular Weight | 254.31 |
| InChIKey | YAZHSSSQPLDAAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=CC=CC=C3C(=O)O |
|
Name: Inhibition of porcine kidney tissue non-specific alkaline phosphatase assessed as res...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1068635
|
|
Name: Inhibition of bovine intestinal alkaline phosphatase assessed as residual enzyme acti...
Source: ChEMBL
Target: Intestinal-type alkaline phosphatase
External Id: CHEMBL1068634
|
Total 2, Current Page 1 of 1
1