2-methylpentan-2-yl 4-nitrobenzoate structure
|
Common Name | 2-methylpentan-2-yl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 68001-66-1 | Molecular Weight | 251.27800 | |
| Density | 1.133g/cm3 | Boiling Point | 356.9ºC at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.5ºC | |
| Name | 2-methylpentan-2-yl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 356.9ºC at 760 mmHg |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.27800 |
| Flash Point | 142.5ºC |
| Exact Mass | 251.11600 |
| PSA | 72.12000 |
| LogP | 3.85350 |
| Index of Refraction | 1.522 |
| InChIKey | UENNBMDLAPCFCW-UHFFFAOYSA-N |
| SMILES | CCCC(C)(C)OC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
2-methylpentan-... CAS#:68001-66-1 |
| Literature: Matsunaga; Miyajima Molecular crystals and liquid crystals, 1984 , vol. 104, # 3-4 p. 353 - 359 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-benzoesaeure-(1,1-dimethyl-butylester) |
| 4-nitro-benzoic acid-(1,1-dimethyl-butyl ester) |