N-hexyl-6-[methyl-(4-propan-2-ylphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide structure
|
Common Name | N-hexyl-6-[methyl-(4-propan-2-ylphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6801-48-5 | Molecular Weight | 483.62300 | |
| Density | 1.207g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H33N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-hexyl-6-[methyl-(4-propan-2-ylphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.62300 |
| Exact Mass | 483.21900 |
| PSA | 111.21000 |
| LogP | 6.44230 |
| Index of Refraction | 1.584 |
| InChIKey | DZVFZPXDYBPEBZ-UHFFFAOYSA-N |
| SMILES | CCCCCCNC(=O)c1c[nH]c2ccc(S(=O)(=O)N(C)c3ccc(C(C)C)cc3)cc2c1=O |
|
~%
N-hexyl-6-[meth... CAS#:6801-48-5 |
| Literature: Knothe, Gerhard; Bagby, Marvin O.; Weisleder, David; Peterson, Robert E. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 7 p. 1661 - 1670 |
|
~%
N-hexyl-6-[meth... CAS#:6801-48-5 |
| Literature: Knothe, Gerhard; Bagby, Marvin O.; Weisleder, David; Peterson, Robert E. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 7 p. 1661 - 1670 |
|
~%
N-hexyl-6-[meth... CAS#:6801-48-5 |
| Literature: Knothe, Gerhard; Bagby, Marvin O.; Weisleder, David; Peterson, Robert E. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 7 p. 1661 - 1670 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,8-Dihydroxyoctadecan |
| K784-1110 |
| HMS1913I07 |
| 1,8-octadecanediol |
| octadecane-1,8-diol |