2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester
Modify Date: 2026-07-07 00:45:47
2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester structure
|
Common Name | 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 680208-55-3 | Molecular Weight | 302.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N2O4 |
|---|---|
| Molecular Weight | 302.32500 |
| Exact Mass | 302.12700 |
| PSA | 69.68000 |
| LogP | 2.57050 |
| InChIKey | GXSUADAWTDGKEZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NCc2ccc(OC)cc2)nc1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:149539-81-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: The English name of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester. |
| Q: What is the CAS number of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: CAS number of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is 680208-55-3. |
| Q: What is the SMILES notation of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: SMILES notation of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is COC(=O)c1ccc(NCc2ccc(OC)cc2)nc1OC. |
| Q: What is the molecular formula of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: Molecular formula of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is C16H18N2O4. |
| Q: What is the InChIKey of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: InChIKey of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is GXSUADAWTDGKEZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: Polar surface area (PSA) of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is 69.68000. |
| Q: What is the Chinese name of 680208-55-3? |
| A: Chinese name of 680208-55-3 is 680208-55-3. |
| Q: What is the molecular weight of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: Molecular weight of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is 302.32500. |
| Q: What are the downstream products of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: Related downstream products(CAS) of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester: 149539-81-1. |
| Q: What is the LogP of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester? |
| A: LogP of 2-methoxy-6-(4-methoxy-benzylamino)-nicotinic acid methyl ester is 2.57050. |