methyl 6-bromo-2-chloroquinoline-4-carboxylate structure
|
Common Name | methyl 6-bromo-2-chloroquinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 680213-43-8 | Molecular Weight | 300.53600 | |
| Density | 1.644g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C11H7BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | methyl 6-bromo-2-chloroquinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.644g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Molecular Formula | C11H7BrClNO2 |
| Molecular Weight | 300.53600 |
| Flash Point | 189.3ºC |
| Exact Mass | 298.93500 |
| PSA | 39.19000 |
| LogP | 3.43730 |
| Index of Refraction | 1.648 |
| InChIKey | BAYLVXXTALAJMT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)nc2ccc(Br)cc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Bromo-2-chloro-quinoline-4-carboxylic acid methyl ester |