(E)-2-cyano-3-(4-nitrophenyl)prop-2-enethioamide
Modify Date: 2025-11-28 18:01:18
(E)-2-cyano-3-(4-nitrophenyl)prop-2-enethioamide structure
|
Common Name | (E)-2-cyano-3-(4-nitrophenyl)prop-2-enethioamide | ||
|---|---|---|---|---|
| CAS Number | 68029-55-0 | Molecular Weight | 233.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-2-cyano-3-(4-nitrophenyl)prop-2-enethioamide |
|---|
| Molecular Formula | C10H7N3O2S |
|---|---|
| Molecular Weight | 233.24600 |
| Exact Mass | 233.02600 |
| PSA | 127.72000 |
| LogP | 3.01138 |
| InChIKey | ZJUPLUDEWMWRRF-VMPITWQZSA-N |
| SMILES | N#CC(=Cc1ccc([N+](=O)[O-])cc1)C(N)=S |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:127118-57-4|
Name: Inhibition of human recombinant Tdp1 assessed as conversion of 14-mer 5'-32P-labeled ...
Source: ChEMBL
Target: Tyrosyl-DNA phosphodiesterase 1
External Id: CHEMBL2174994
|
Total 1, Current Page 1 of 1
1