(11SR,13RS,14RS)-corynoline structure
|
Common Name | (11SR,13RS,14RS)-corynoline | ||
|---|---|---|---|---|
| CAS Number | 68035-45-0 | Molecular Weight | 367.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (11SR,13RS,14RS)-corynoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H21NO5 |
|---|---|
| Molecular Weight | 367.39500 |
| Exact Mass | 367.14200 |
| PSA | 60.39000 |
| LogP | 2.44330 |
| InChIKey | IQUGPRHKZNCHGC-TYPHKJRUSA-N |
| SMILES | CN1Cc2c(ccc3c2OCO3)C2(C)C(O)Cc3cc4c(cc3C12)OCO4 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Inhibition of recombinant human MAO-B assessed as residual activity at 20 uM using be...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL4125423
|
|
Name: Inhibition of recombinant human MAO-A assessed as residual activity at 20 uM using ky...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL4125422
|
|
Name: Antiinflammatory activity against mouse RAW264.7 cells assessed as inhibition of LPS ...
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL4124263
|
| (+/-)-Corynolin |
| 5b,13-dimethyl-(5br,12bc)-5b,6,7,12b,13,14-hexahydro-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-6t-ol |
| (+/-)-13-methyl-chelidonine |
| (+/-)-corynoline |
| (+/-)-corynoline |
| Corynolin |