(11SR,13RS,14RS)-corynoline
(11SR,13RS,14RS)-corynoline structure
|
Common Name | (11SR,13RS,14RS)-corynoline | ||
|---|---|---|---|---|
| CAS Number | 68035-45-0 | Molecular Weight | 367.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (11SR,13RS,14RS)-corynoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21NO5 |
|---|---|
| Molecular Weight | 367.39500 |
| Exact Mass | 367.14200 |
| PSA | 60.39000 |
| LogP | 2.44330 |
| InChIKey | IQUGPRHKZNCHGC-TYPHKJRUSA-N |
| SMILES | CN1Cc2c(ccc3c2OCO3)C2(C)C(O)Cc3cc4c(cc3C12)OCO4 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:18797-80-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of recombinant human MAO-B assessed as residual activity at 20 uM using be...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL4125423
|
|
Name: Inhibition of recombinant human MAO-A assessed as residual activity at 20 uM using ky...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL4125422
|
|
Name: Antiinflammatory activity against mouse RAW264.7 cells assessed as inhibition of LPS ...
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL4124263
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (+/-)-Corynolin |
| 5b,13-dimethyl-(5br,12bc)-5b,6,7,12b,13,14-hexahydro-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-6t-ol |
| (+/-)-13-methyl-chelidonine |
| (+/-)-corynoline |
| (+/-)-corynoline |
| Corynolin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (11SR,13RS,14RS)-corynoline have? |
| A: English synonyms of (11SR,13RS,14RS)-corynoline: (+/-)-Corynolin, 5b,13-dimethyl-(5br,12bc)-5b,6,7,12b,13,14-hexahydro-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-6t-ol, (+/-)-13-methyl-chelidonine, (+/-)-corynoline, (+/-)-corynoline, Corynolin. |
| Q: What is the CAS number of (11SR,13RS,14RS)-corynoline? |
| A: CAS number of (11SR,13RS,14RS)-corynoline is 68035-45-0. |
| Q: What is the SMILES notation of (11SR,13RS,14RS)-corynoline? |
| A: SMILES notation of (11SR,13RS,14RS)-corynoline is CN1Cc2c(ccc3c2OCO3)C2(C)C(O)Cc3cc4c(cc3C12)OCO4. |
| Q: What is the LogP of (11SR,13RS,14RS)-corynoline? |
| A: LogP of (11SR,13RS,14RS)-corynoline is 2.44330. |
| Q: What is the English name of (11SR,13RS,14RS)-corynoline? |
| A: The English name of (11SR,13RS,14RS)-corynoline is (11SR,13RS,14RS)-corynoline. |
| Q: What is the polar surface area (PSA) of (11SR,13RS,14RS)-corynoline? |
| A: Polar surface area (PSA) of (11SR,13RS,14RS)-corynoline is 60.39000. |
| Q: What are the downstream products of (11SR,13RS,14RS)-corynoline? |
| A: Related downstream products(CAS) of (11SR,13RS,14RS)-corynoline: 18797-80-3. |
| Q: What is the Chinese name of 68035-45-0? |
| A: Chinese name of 68035-45-0 is 68035-45-0. |
| Q: What is the InChIKey of (11SR,13RS,14RS)-corynoline? |
| A: InChIKey of (11SR,13RS,14RS)-corynoline is IQUGPRHKZNCHGC-TYPHKJRUSA-N. |
| Q: What is the molecular weight of (11SR,13RS,14RS)-corynoline? |
| A: Molecular weight of (11SR,13RS,14RS)-corynoline is 367.39500. |