4-acetamido-5-methoxy-2-methylbenzenesulphonyl chloride
4-acetamido-5-methoxy-2-methylbenzenesulphonyl chloride structure
|
Common Name | 4-acetamido-5-methoxy-2-methylbenzenesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 68039-14-5 | Molecular Weight | 277.72500 | |
| Density | 1.392g/cm3 | Boiling Point | 429.3ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 429.3ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.72500 |
| Flash Point | 213.4ºC |
| Exact Mass | 277.01800 |
| PSA | 84.34000 |
| LogP | 3.61980 |
| Index of Refraction | 1.559 |
| InChIKey | XWRBAVORXAXIRN-UHFFFAOYSA-N |
| SMILES | COc1cc(S(=O)(=O)Cl)c(C)cc1NC(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-acetamido-5-m... CAS#:68039-14-5 |
| Literature: I.G. Farbenind. Patent: DE681686 , 1937 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 25, p. 376 Full Text Show Details Winthrop Chem. Co. Patent: US2202219 , 1938 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:49564-57-0
CAS#:98489-97-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Acetamido-5-methoxy-2-methylbenzenesulphonyl chloride |
| 4-Acetylamino-5-methoxy-2-methylbenzenesulfonyl chloride |
| 5-acetylamino-4-methoxy-toluene-2-sulfonyl chloride |
| EINECS 268-233-2 |
| 5-Acetylamino-4-methoxy-toluol-2-sulfonylchlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride have? |
| A: English synonyms of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride: 4-Acetamido-5-methoxy-2-methylbenzenesulphonyl chloride, 4-Acetylamino-5-methoxy-2-methylbenzenesulfonyl chloride, 5-acetylamino-4-methoxy-toluene-2-sulfonyl chloride, EINECS 268-233-2, 5-Acetylamino-4-methoxy-toluol-2-sulfonylchlorid. |
| Q: What is the molecular formula of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: Molecular formula of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is C10H12ClNO4S. |
| Q: What is the boiling point of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: Boiling point of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is 429.3ºC at 760 mmHg. |
| Q: What is the Chinese name of 68039-14-5? |
| A: Chinese name of 68039-14-5 is 68039-14-5. |
| Q: What is the SMILES notation of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: SMILES notation of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is COc1cc(S(=O)(=O)Cl)c(C)cc1NC(C)=O. |
| Q: What is the molecular weight of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: Molecular weight of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is 277.72500. |
| Q: What is the polar surface area (PSA) of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: Polar surface area (PSA) of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is 84.34000. |
| Q: What is the InChIKey of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: InChIKey of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is XWRBAVORXAXIRN-UHFFFAOYSA-N. |
| Q: What are the downstream products of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: Related downstream products(CAS) of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride: 49564-57-0;98489-97-5. |
| Q: What is the English name of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride? |
| A: The English name of 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride is 4-acetamido-5-methoxy-2-methylbenzenesulfonyl chloride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |