di(tert-pentyl)naphthalenesulphonic acid, compound with butylamine (1:1) structure
|
Common Name | di(tert-pentyl)naphthalenesulphonic acid, compound with butylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68039-67-8 | Molecular Weight | 421.63600 | |
| Density | N/A | Boiling Point | 568.9ºC at 760 mmHg | |
| Molecular Formula | C24H39NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.8ºC | |
| Name | 2,3-bis(2-methylbutan-2-yl)naphthalene-1-sulfonic acid,butan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 568.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H39NO3S |
| Molecular Weight | 421.63600 |
| Flash Point | 297.8ºC |
| Exact Mass | 421.26500 |
| PSA | 88.77000 |
| LogP | 7.98800 |
| InChIKey | AOGCOXLJYRCVPB-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1cc2ccccc2c(S(=O)(=O)O)c1C(C)(C)CC.CCCCN |
| Di-tert-amylnaphthalenesulfonic acid,butylamine salt |
| EINECS 268-274-6 |