[(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid
Modify Date: 2026-09-21 12:44:14
![[(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid Structure](https://image.chemsrc.com/caspic/125/680591-44-0.png)
[(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid structure
|
Common Name | [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 680591-44-0 | Molecular Weight | 336.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N2O5S |
|---|---|
| Molecular Weight | 336.36300 |
| Exact Mass | 336.07800 |
| PSA | 105.18000 |
| LogP | 2.75930 |
| InChIKey | MQCMHESYTKWLGP-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(CC(=O)O)S(=O)(=O)c2ccccc2C)cn1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:680590-49-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: LogP of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is 2.75930. |
| Q: What is the CAS number of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: CAS number of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is 680591-44-0. |
| Q: What is the InChIKey of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: InChIKey of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is MQCMHESYTKWLGP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: Polar surface area (PSA) of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is 105.18000. |
| Q: What is the molecular weight of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: Molecular weight of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is 336.36300. |
| Q: What is the molecular formula of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: Molecular formula of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is C15H16N2O5S. |
| Q: What is the SMILES notation of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: SMILES notation of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is COc1ccc(N(CC(=O)O)S(=O)(=O)c2ccccc2C)cn1. |
| Q: What are the downstream products of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: Related downstream products(CAS) of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid: 680590-49-2. |
| Q: What is the Chinese name of 680591-44-0? |
| A: Chinese name of 680591-44-0 is 680591-44-0. |
| Q: What is the English name of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid? |
| A: The English name of [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid is [(6-methoxy-pyridin-3-yl)-(toluene-2-sulfonyl)-amino]-acetic acid. |