2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole
Modify Date: 2026-07-17 18:09:37
2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole structure
|
Common Name | 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole | ||
|---|---|---|---|---|
| CAS Number | 680612-08-2 | Molecular Weight | 362.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H17F3N2O2 |
|---|---|
| Molecular Weight | 362.34600 |
| Exact Mass | 362.12400 |
| PSA | 36.28000 |
| LogP | 4.92530 |
| InChIKey | BHECNALQBQWOCI-UHFFFAOYSA-N |
| SMILES | C=CCn1nc2c(C(F)(F)F)cccc2c1-c1ccc(OC)cc1OC |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| SGA 294 |
| 2-allyl-3-(2,4-dimethoxyphenyl)-7-trifluoromethyl-2H-indazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: Molecular formula of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is C19H17F3N2O2. |
| Q: What is the Chinese name of 680612-08-2? |
| A: Chinese name of 680612-08-2 is 680612-08-2. |
| Q: What is the molecular weight of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: Molecular weight of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is 362.34600. |
| Q: What is the English name of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: The English name of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole. |
| Q: What is the CAS number of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: CAS number of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is 680612-08-2. |
| Q: What English synonyms does 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole have? |
| A: English synonyms of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole: SGA 294, 2-allyl-3-(2,4-dimethoxyphenyl)-7-trifluoromethyl-2H-indazole. |
| Q: What is the polar surface area (PSA) of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: Polar surface area (PSA) of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is 36.28000. |
| Q: What is the LogP of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: LogP of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is 4.92530. |
| Q: What is the SMILES notation of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: SMILES notation of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is C=CCn1nc2c(C(F)(F)F)cccc2c1-c1ccc(OC)cc1OC. |
| Q: What is the InChIKey of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole? |
| A: InChIKey of 2-allyl-3-(2,4-dimethoxyphenyl)-7-(trifluoromethyl)-2H-indazole is BHECNALQBQWOCI-UHFFFAOYSA-N. |