4-chlorobenzenesulfonic acid hydrate
Modify Date: 2026-08-14 19:56:04
4-chlorobenzenesulfonic acid hydrate structure
|
Common Name | 4-chlorobenzenesulfonic acid hydrate | ||
|---|---|---|---|---|
| CAS Number | 68066-38-6 | Molecular Weight | 210.63500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chlorobenzenesulfonic acid hydrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H7ClO4S |
|---|---|
| Molecular Weight | 210.63500 |
| Exact Mass | 209.97500 |
| PSA | 71.98000 |
| LogP | 2.60320 |
| InChIKey | JCARZMZFSSKOAW-UHFFFAOYSA-N |
| SMILES | O.O=S(=O)(O)c1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:1142-19-4
CAS#:106-54-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-chlorobenzenesulfonic acid hydrate? |
| A: SMILES notation of 4-chlorobenzenesulfonic acid hydrate is O.O=S(=O)(O)c1ccc(Cl)cc1. |
| Q: What is the CAS number of 4-chlorobenzenesulfonic acid hydrate? |
| A: CAS number of 4-chlorobenzenesulfonic acid hydrate is 68066-38-6. |
| Q: What is the molecular weight of 4-chlorobenzenesulfonic acid hydrate? |
| A: Molecular weight of 4-chlorobenzenesulfonic acid hydrate is 210.63500. |
| Q: What are the downstream products of 4-chlorobenzenesulfonic acid hydrate? |
| A: Related downstream products(CAS) of 4-chlorobenzenesulfonic acid hydrate: 1142-19-4;106-54-7. |
| Q: What is the LogP of 4-chlorobenzenesulfonic acid hydrate? |
| A: LogP of 4-chlorobenzenesulfonic acid hydrate is 2.60320. |
| Q: What is the InChIKey of 4-chlorobenzenesulfonic acid hydrate? |
| A: InChIKey of 4-chlorobenzenesulfonic acid hydrate is JCARZMZFSSKOAW-UHFFFAOYSA-N. |
| Q: What is the English name of 4-chlorobenzenesulfonic acid hydrate? |
| A: The English name of 4-chlorobenzenesulfonic acid hydrate is 4-chlorobenzenesulfonic acid hydrate. |
| Q: What is the Chinese name of 68066-38-6? |
| A: Chinese name of 68066-38-6 is 68066-38-6. |
| Q: What is the polar surface area (PSA) of 4-chlorobenzenesulfonic acid hydrate? |
| A: Polar surface area (PSA) of 4-chlorobenzenesulfonic acid hydrate is 71.98000. |
| Q: What is the molecular formula of 4-chlorobenzenesulfonic acid hydrate? |
| A: Molecular formula of 4-chlorobenzenesulfonic acid hydrate is C6H7ClO4S. |