3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate
Modify Date: 2025-09-05 18:26:14
3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate structure
|
Common Name | 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 68076-37-9 | Molecular Weight | 363.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO5S |
|---|---|
| Molecular Weight | 363.4 |
| InChIKey | WJJVQUFWIDODJM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCNC(=O)OCc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate? |
| A: CAS number of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate is 68076-37-9. |
| Q: What is the molecular weight of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate? |
| A: Molecular weight of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate is 363.4. |
| Q: What is the English name of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate? |
| A: The English name of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate is 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate. |
| Q: What is the Chinese name of 68076-37-9? |
| A: Chinese name of 68076-37-9 is 68076-37-9. |
| Q: What is the InChIKey of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate? |
| A: InChIKey of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate is WJJVQUFWIDODJM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate? |
| A: Molecular formula of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate is C18H21NO5S. |
| Q: What is the SMILES notation of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate? |
| A: SMILES notation of 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCNC(=O)OCc2ccccc2)cc1. |