N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane
N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane structure
|
Common Name | N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane | ||
|---|---|---|---|---|
| CAS Number | 68076-41-5 | Molecular Weight | 341.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H31N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H31N3O4 |
|---|---|
| Molecular Weight | 341.44600 |
| Exact Mass | 341.23100 |
| PSA | 91.66000 |
| LogP | 3.83298 |
| InChIKey | YOOSBMUYQHBONG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCC#N)C(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:68076-39-1This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against mouse RAW264.7 cells assessed as reduction in cell viability up ...
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL3373061
|
|
Name: Antikinetoplastid activity against Leishmania donovani LV9 axenic amastigotes in mous...
Source: ChEMBL
Target: Leishmania donovani
External Id: CHEMBL3373060
|
|
Name: Antikinetoplastid activity against Trypanosoma brucei gambiense assessed as parasite ...
Source: ChEMBL
Target: Trypanosoma brucei
External Id: CHEMBL3373059
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl (4-(tert-butoxycarbonylamino)butyl)(2-cyanoethyl)carbamate |
| (4-tert-butoxycarbonylaminobutyl)(2-cyanoethyl)carbamic acid tert-butyl ester |
| Di(tert-butyl)-N-(2-cyanoethyl)-N,N'-(butan-1,4-diyl)bis[carbamat] |
| (4-tert-butoxycarbonylaminobutyl)-(2-cyanoethyl)carbamic acid tert-butyl ester |
| tert-butyl 2-cyanoethyl-{4-[(tert-butoxycarbonyl)amino]butyl}carbamate |
| tert-butyl N-(4-([(tert-butyloxy)carbonyl]amino)butyl)-N-(2-cyanoethyl)carbamate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: Related downstream products(CAS) of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane: 68076-39-1. |
| Q: What is the molecular weight of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: Molecular weight of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is 341.44600. |
| Q: What is the Chinese name of 68076-41-5? |
| A: Chinese name of 68076-41-5 is 68076-41-5. |
| Q: What is the LogP of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: LogP of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is 3.83298. |
| Q: What is the CAS number of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: CAS number of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is 68076-41-5. |
| Q: What is the polar surface area (PSA) of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: Polar surface area (PSA) of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is 91.66000. |
| Q: What is the molecular formula of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: Molecular formula of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is C17H31N3O4. |
| Q: What is the InChIKey of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: InChIKey of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is YOOSBMUYQHBONG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: SMILES notation of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is CC(C)(C)OC(=O)NCCCCN(CCC#N)C(=O)OC(C)(C)C. |
| Q: What is the English name of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane? |
| A: The English name of N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane is N1,N4-di-tert-butyloxycarbonyl N4-(2'-cyanoethyl)-1,4-diaminobutane. |