1-Propene-1,2,3-tricarboxylicacid, triethyl ester, (E)- (9CI)
Modify Date: 2025-09-15 11:55:40
1-Propene-1,2,3-tricarboxylicacid, triethyl ester, (E)- (9CI) structure
|
Common Name | 1-Propene-1,2,3-tricarboxylicacid, triethyl ester, (E)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 68077-28-1 | Molecular Weight | 258.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trans-Aconitsaeure-triaethylester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18O6 |
|---|---|
| Molecular Weight | 258.26800 |
| Exact Mass | 258.11000 |
| PSA | 78.90000 |
| LogP | 0.99220 |
| InChIKey | IDDWGDKSBYYEPL-VQHVLOKHSA-N |
| SMILES | CCOC(=O)C=C(CC(=O)OCC)C(=O)OCC |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| (E)-1-propene-1,2,3-tricarboxylic acid,triethyl ester |
| 1-Propene-1,2,3-tricarboxylic acid,3-methyl ester,(Z) |
| trans-Aconitsaeuretriethylester |
| propene-1c,2,3-tricarboxylic acid triethyl ester |
| 1-Propene-1,2,3-tricarboxylic acid,3-methyl ester,(E) |
| Propen-1c,2,3-tricarbonsaeure-triaethylester |
| ethyl aconitate |