2-[2-(phenylcarbamoyl)phenyl]benzoic acid structure
|
Common Name | 2-[2-(phenylcarbamoyl)phenyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6809-72-9 | Molecular Weight | 317.33800 | |
| Density | 1.289g/cm3 | Boiling Point | 451.3ºC at 760 mmHg | |
| Molecular Formula | C20H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | 2-[2-(phenylcarbamoyl)phenyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 451.3ºC at 760 mmHg |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.33800 |
| Flash Point | 226.7ºC |
| Exact Mass | 317.10500 |
| PSA | 66.40000 |
| LogP | 4.37710 |
| Index of Refraction | 1.673 |
| InChIKey | IMNAHFIVWBGYDS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1-c1ccccc1C(=O)Nc1ccccc1 |
|
~%
2-[2-(phenylcar... CAS#:6809-72-9 |
| Literature: Bell; Briggs Journal of the Chemical Society, 1941 , p. 282 Full Text Show Details Warren; Briggs Chemische Berichte, 1931 , vol. 64, p. 26,27 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Diphenanilic acid |
| Diphensaeure-monoanilid |
| N-Phenyl-diphenamidsaeure |
| Diphenanilsaeure |
| N-phenyl-diphenamic acid |
| 2'-phenylcarbamoyl-biphenyl-2-carboxylic acid |